C12H16N2S — CID 83917658
2-N,2-N-diethyl-1-benzothiophene-2,5-diamine (PubChem CID 83917658) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1-benzothiophene-2,5-diamine.
| Compound Name | 2-N,2-N-diethyl-1-benzothiophene-2,5-diamine |
|---|---|
| PubChem CID | 83917658 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-N,2-N-diethyl-1-benzothiophene-2,5-diamine |
| SMILES | CCN(CC)c1cc2cc(N)ccc2s1 |
| InChI | InChI=1S/C12H16N2S/c1-3-14(4-2)12-8-9-7-10(13)5-6-11(9)15-12/h5-8H,3-4,13H2,1-2H3 |
| InChIKey | IEFPYXALEZRIHQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|