(E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid

C15H19ClO2 — CID 83957877

IUPAC(E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid
SMILESCCC/C(=C\CC(=O)O)c1cc(C)c(C)cc1Cl
InChIInChI=1S/C15H19ClO2/c1-4-5-12(6-7-15(17)18)13-8-10(2)11(3)9-14(13)16/h6,8-9H,4-5,7H2,1-3H3,(H,17,18)/b12-6+
InChIKeyWFHDYELZWKUYOC-WUXMJOGZSA-N
MW266.77 g/mol
LogP4.62
Rot. Bonds5

About (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid

(E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid (PubChem CID 83957877) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid.

Molecular Properties

Compound Name(E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid
PubChem CID83957877
Molecular FormulaC15H19ClO2
Molecular Weight266.77 g/mol
Exact Mass266.11
IUPAC Name(E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid
SMILESCCC/C(=C\CC(=O)O)c1cc(C)c(C)cc1Cl
InChIInChI=1S/C15H19ClO2/c1-4-5-12(6-7-15(17)18)13-8-10(2)11(3)9-14(13)16/h6,8-9H,4-5,7H2,1-3H3,(H,17,18)/b12-6+
InChIKeyWFHDYELZWKUYOC-WUXMJOGZSA-N
XLogP4.62
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.77
LogP ≤ 54.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid?
The IUPAC name of (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid (CID 83957877) is (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid.
What is the SMILES notation for (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid?
The canonical SMILES for (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid is CCC/C(=C\CC(=O)O)c1cc(C)c(C)cc1Cl.
What is the InChIKey of (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid?
The InChIKey is WFHDYELZWKUYOC-WUXMJOGZSA-N. The full InChI is InChI=1S/C15H19ClO2/c1-4-5-12(6-7-15(17)18)13-8-10(2)11(3)9-14(13)16/h6,8-9H,4-5,7H2,1-3H3,(H,17,18)/b12-6+.
What are the key properties of (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid?
(E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid has a molecular weight of 266.77 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2-chloro-4,5-dimethylphenyl)hept-3-enoic acid is sourced from PubChem (CID 83957877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).