C13H15ClN4O2 — CID 83968285
4-[3-(3-aminopropyl)-5-(chloromethyl)-1,2,4-triazol-4-yl]benzoic acid (PubChem CID 83968285) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 4-[3-(3-aminopropyl)-5-(chloromethyl)-1,2,4-triazol-4-yl]benzoic acid.
| Compound Name | 4-[3-(3-aminopropyl)-5-(chloromethyl)-1,2,4-triazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 83968285 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[3-(3-aminopropyl)-5-(chloromethyl)-1,2,4-triazol-4-yl]benzoic acid |
| SMILES | NCCCc1nnc(CCl)n1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H15ClN4O2/c14-8-12-17-16-11(2-1-7-15)18(12)10-5-3-9(4-6-10)13(19)20/h3-6H,1-2,7-8,15H2,(H,19,20) |
| InChIKey | UJNQFBGINIGRPE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|