C10H7BrN4S — CID 840996
8-bromo-5-methyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 840996) has the molecular formula C10H7BrN4S and a molecular weight of 295.17 g/mol. Its IUPAC name is 8-bromo-5-methyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 8-bromo-5-methyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 840996 |
| Molecular Formula | C10H7BrN4S |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 8-bromo-5-methyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | Cn1c2ccc(Br)cc2c2n[nH]c(=S)nc21 |
| InChI | InChI=1S/C10H7BrN4S/c1-15-7-3-2-5(11)4-6(7)8-9(15)12-10(16)14-13-8/h2-4H,1H3,(H,12,14,16) |
| InChIKey | GYYYEIYZUFTNDW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|