C13H11Cl2NOS — CID 84554043
N-(2,4-dichlorophenyl)-4,5-dimethylthiophene-3-carboxamide (PubChem CID 84554043) has the molecular formula C13H11Cl2NOS and a molecular weight of 300.21 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 84554043 |
| Molecular Formula | C13H11Cl2NOS |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1scc(C(=O)Nc2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C13H11Cl2NOS/c1-7-8(2)18-6-10(7)13(17)16-12-4-3-9(14)5-11(12)15/h3-6H,1-2H3,(H,16,17) |
| InChIKey | JZRJAUPIWHCYBD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |