C19H27NO3 — CID 84575849
(E)-3-(3,4-dimethoxyphenyl)-1-(3,5-dimethylpiperidin-1-yl)-2-methylprop-2-en-1-one (PubChem CID 84575849) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-(3,5-dimethylpiperidin-1-yl)-2-methylprop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-(3,5-dimethylpiperidin-1-yl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 84575849 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-(3,5-dimethylpiperidin-1-yl)-2-methylprop-2-en-1-one |
| SMILES | COc1ccc(/C=C(\C)C(=O)N2CC(C)CC(C)C2)cc1OC |
| InChI | InChI=1S/C19H27NO3/c1-13-8-14(2)12-20(11-13)19(21)15(3)9-16-6-7-17(22-4)18(10-16)23-5/h6-7,9-10,13-14H,8,11-12H2,1-5H3/b15-9+ |
| InChIKey | CIVNASIVTNRPAN-OQLLNIDSSA-N |
| XLogP | 3.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|