C14H18N4S — CID 84593931
N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine (PubChem CID 84593931) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine.
| Compound Name | N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine |
|---|---|
| PubChem CID | 84593931 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]thian-4-amine |
| SMILES | c1ccc(NC2CCSCC2)c(Cn2cncn2)c1 |
| InChI | InChI=1S/C14H18N4S/c1-2-4-14(17-13-5-7-19-8-6-13)12(3-1)9-18-11-15-10-16-18/h1-4,10-11,13,17H,5-9H2 |
| InChIKey | MCRLCAISHDISHH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |