C16H15N5O2S — CID 84595221
7-N-prop-2-enyl-7-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-3,7-dicarboxamide (PubChem CID 84595221) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is 7-N-prop-2-enyl-7-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-3,7-dicarboxamide.
| Compound Name | 7-N-prop-2-enyl-7-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-3,7-dicarboxamide |
|---|---|
| PubChem CID | 84595221 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 7-N-prop-2-enyl-7-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-3,7-dicarboxamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)c1ccnc2c(C(N)=O)cnn12 |
| InChI | InChI=1S/C16H15N5O2S/c1-2-7-20(10-11-4-3-8-24-11)16(23)13-5-6-18-15-12(14(17)22)9-19-21(13)15/h2-6,8-9H,1,7,10H2,(H2,17,22) |
| InChIKey | RSGXYRYIQOMHQA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|