C17H25FN2O2S — CID 84598096
N-(1,1-dioxothian-3-yl)-1-[(2-fluorophenyl)methyl]piperidin-4-amine (PubChem CID 84598096) has the molecular formula C17H25FN2O2S and a molecular weight of 340.46 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-1-[(2-fluorophenyl)methyl]piperidin-4-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-1-[(2-fluorophenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 84598096 |
| Molecular Formula | C17H25FN2O2S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-1-[(2-fluorophenyl)methyl]piperidin-4-amine |
| SMILES | O=S1(=O)CCCC(NC2CCN(Cc3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C17H25FN2O2S/c18-17-6-2-1-4-14(17)12-20-9-7-15(8-10-20)19-16-5-3-11-23(21,22)13-16/h1-2,4,6,15-16,19H,3,5,7-13H2 |
| InChIKey | LFRLZMCVMAHUIH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |