C11H12F2N2O2 — CID 84630179
4-(3-aminopropyl)-5,7-difluoro-1,4-benzoxazin-3-one (PubChem CID 84630179) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is 4-(3-aminopropyl)-5,7-difluoro-1,4-benzoxazin-3-one.
| Compound Name | 4-(3-aminopropyl)-5,7-difluoro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 84630179 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-(3-aminopropyl)-5,7-difluoro-1,4-benzoxazin-3-one |
| SMILES | NCCCN1C(=O)COc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C11H12F2N2O2/c12-7-4-8(13)11-9(5-7)17-6-10(16)15(11)3-1-2-14/h4-5H,1-3,6,14H2 |
| InChIKey | MXVQJMYTSHEWEL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |