C14H19BrN2 — CID 84644248
8-bromo-6,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine (PubChem CID 84644248) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 8-bromo-6,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine.
| Compound Name | 8-bromo-6,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine |
|---|---|
| PubChem CID | 84644248 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 8-bromo-6,10-dimethyl-2,3,4,4a,5,10a-hexahydro-1H-phenazine |
| SMILES | Cc1cc(Br)cc2c1NC1CCCCC1N2C |
| InChI | InChI=1S/C14H19BrN2/c1-9-7-10(15)8-13-14(9)16-11-5-3-4-6-12(11)17(13)2/h7-8,11-12,16H,3-6H2,1-2H3 |
| InChIKey | CZJNELXPFJFQDU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |