C8H6F2N2O — CID 84659396
3-(difluoromethyl)-1,2-benzoxazol-7-amine (PubChem CID 84659396) has the molecular formula C8H6F2N2O and a molecular weight of 184.15 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,2-benzoxazol-7-amine.
| Compound Name | 3-(difluoromethyl)-1,2-benzoxazol-7-amine |
|---|---|
| PubChem CID | 84659396 |
| Molecular Formula | C8H6F2N2O |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 3-(difluoromethyl)-1,2-benzoxazol-7-amine |
| SMILES | Nc1cccc2c(C(F)F)noc12 |
| InChI | InChI=1S/C8H6F2N2O/c9-8(10)6-4-2-1-3-5(11)7(4)13-12-6/h1-3,8H,11H2 |
| InChIKey | HLFGWYJEWVFPNS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|