C25H14N2O3 — CID 163616771
6,24-diamino-4,26-dioxaheptacyclo[14.11.0.02,14.03,11.05,10.019,27.020,25]heptacosa-1(16),2(14),3(11),5(10),6,8,12,17,19(27),20(25),21,23-dodecaen-15-one (PubChem CID 163616771) has the molecular formula C25H14N2O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 6,24-diamino-4,26-dioxaheptacyclo[14.11.0.02,14.03,11.05,10.019,27.020,25]heptacosa-1(16),2(14),3(11),5(10),6,8,12,17,19(27),20(25),21,23-dodecaen-15-one.
| Compound Name | 6,24-diamino-4,26-dioxaheptacyclo[14.11.0.02,14.03,11.05,10.019,27.020,25]heptacosa-1(16),2(14),3(11),5(10),6,8,12,17,19(27),20(25),21,23-dodecaen-15-one |
|---|---|
| PubChem CID | 163616771 |
| Molecular Formula | C25H14N2O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 6,24-diamino-4,26-dioxaheptacyclo[14.11.0.02,14.03,11.05,10.019,27.020,25]heptacosa-1(16),2(14),3(11),5(10),6,8,12,17,19(27),20(25),21,23-dodecaen-15-one |
| SMILES | Nc1cccc2c1oc1c3c(ccc12)C(=O)c1ccc2c(oc4c(N)cccc42)c1-3 |
| InChI | InChI=1S/C25H14N2O3/c26-17-5-1-3-11-13-7-9-15-19(24(13)29-22(11)17)20-16(21(15)28)10-8-14-12-4-2-6-18(27)23(12)30-25(14)20/h1-10H,26-27H2 |
| InChIKey | HKQYIBPJVWGDKP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|