C10H13N3O — CID 84663288
(7-ethoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)methanamine (PubChem CID 84663288) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (7-ethoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)methanamine.
| Compound Name | (7-ethoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 84663288 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (7-ethoxy-1H-pyrrolo[3,2-b]pyridin-3-yl)methanamine |
| SMILES | CCOc1ccnc2c(CN)c[nH]c12 |
| InChI | InChI=1S/C10H13N3O/c1-2-14-8-3-4-12-9-7(5-11)6-13-10(8)9/h3-4,6,13H,2,5,11H2,1H3 |
| InChIKey | VMQSVLJIAOOUDJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |