C11H14FN — CID 84718195
2-ethyl-7-fluoro-2-methyl-1,3-dihydroindole (PubChem CID 84718195) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-ethyl-7-fluoro-2-methyl-1,3-dihydroindole.
| Compound Name | 2-ethyl-7-fluoro-2-methyl-1,3-dihydroindole |
|---|---|
| PubChem CID | 84718195 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-ethyl-7-fluoro-2-methyl-1,3-dihydroindole |
| SMILES | CCC1(C)Cc2cccc(F)c2N1 |
| InChI | InChI=1S/C11H14FN/c1-3-11(2)7-8-5-4-6-9(12)10(8)13-11/h4-6,13H,3,7H2,1-2H3 |
| InChIKey | SGZXOUJAMXIMAW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |