About 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one
3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one (PubChem CID 84723983) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one |
| PubChem CID | 84723983 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one |
| SMILES | CC(=O)c1ccc(-c2[nH]oc(=O)c2C)cc1 |
| InChI | InChI=1S/C12H11NO3/c1-7-11(13-16-12(7)15)10-5-3-9(4-6-10)8(2)14/h3-6,13H,1-2H3 |
| InChIKey | CUUHNNPRXBGMDR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one?
The IUPAC name of 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one (CID 84723983) is 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one?
The canonical SMILES for 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one is CC(=O)c1ccc(-c2[nH]oc(=O)c2C)cc1.
What is the InChIKey of 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one?
The InChIKey is CUUHNNPRXBGMDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c1-7-11(13-16-12(7)15)10-5-3-9(4-6-10)8(2)14/h3-6,13H,1-2H3.
What are the key properties of 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one?
3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one has a molecular weight of 217.22 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-acetylphenyl)-4-methyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 84723983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).