N-(2,6-dimethylphenyl)sulfamoyl chloride

C8H10ClNO2S — CID 84760590

IUPACN-(2,6-dimethylphenyl)sulfamoyl chloride
SMILESCc1cccc(C)c1NS(=O)(=O)Cl
InChIInChI=1S/C8H10ClNO2S/c1-6-4-3-5-7(2)8(6)10-13(9,11)12/h3-5,10H,1-2H3
InChIKeySLKQSQPONPWPRV-UHFFFAOYSA-N
MW219.69 g/mol
LogP2.20
Rot. Bonds2

About N-(2,6-dimethylphenyl)sulfamoyl chloride

N-(2,6-dimethylphenyl)sulfamoyl chloride (PubChem CID 84760590) has the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)sulfamoyl chloride.

Molecular Properties

Compound NameN-(2,6-dimethylphenyl)sulfamoyl chloride
PubChem CID84760590
Molecular FormulaC8H10ClNO2S
Molecular Weight219.69 g/mol
Exact Mass219.01
IUPAC NameN-(2,6-dimethylphenyl)sulfamoyl chloride
SMILESCc1cccc(C)c1NS(=O)(=O)Cl
InChIInChI=1S/C8H10ClNO2S/c1-6-4-3-5-7(2)8(6)10-13(9,11)12/h3-5,10H,1-2H3
InChIKeySLKQSQPONPWPRV-UHFFFAOYSA-N
XLogP2.20
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.69
LogP ≤ 52.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-(2,6-dimethylphenyl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2,6-dimethylphenyl)sulfamoyl chloride?
The IUPAC name of N-(2,6-dimethylphenyl)sulfamoyl chloride (CID 84760590) is N-(2,6-dimethylphenyl)sulfamoyl chloride.
What is the SMILES notation for N-(2,6-dimethylphenyl)sulfamoyl chloride?
The canonical SMILES for N-(2,6-dimethylphenyl)sulfamoyl chloride is Cc1cccc(C)c1NS(=O)(=O)Cl.
What is the InChIKey of N-(2,6-dimethylphenyl)sulfamoyl chloride?
The InChIKey is SLKQSQPONPWPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO2S/c1-6-4-3-5-7(2)8(6)10-13(9,11)12/h3-5,10H,1-2H3.
What are the key properties of N-(2,6-dimethylphenyl)sulfamoyl chloride?
N-(2,6-dimethylphenyl)sulfamoyl chloride has a molecular weight of 219.69 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylphenyl)sulfamoyl chloride is sourced from PubChem (CID 84760590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).