C10H14N4O2S2 — CID 84762001
3-[2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 84762001) has the molecular formula C10H14N4O2S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-[2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 84762001 |
| Molecular Formula | C10H14N4O2S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-[2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | NCCc1csc(NCCN2C(=O)CSC2=O)n1 |
| InChI | InChI=1S/C10H14N4O2S2/c11-2-1-7-5-17-9(13-7)12-3-4-14-8(15)6-18-10(14)16/h5H,1-4,6,11H2,(H,12,13) |
| InChIKey | HKAZOWCCNNSEFG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|