C9H7NO2 — CID 84764334
1-(2,1-benzoxazol-6-yl)ethanone (PubChem CID 84764334) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 1-(2,1-benzoxazol-6-yl)ethanone.
| Compound Name | 1-(2,1-benzoxazol-6-yl)ethanone |
|---|---|
| PubChem CID | 84764334 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 1-(2,1-benzoxazol-6-yl)ethanone |
| SMILES | CC(=O)c1ccc2conc2c1 |
| InChI | InChI=1S/C9H7NO2/c1-6(11)7-2-3-8-5-12-10-9(8)4-7/h2-5H,1H3 |
| InChIKey | KLBDDABZRLSEEW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |