C8H9N3S — CID 84767967
3-(aminomethyl)-1,2-benzothiazol-4-amine (PubChem CID 84767967) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 3-(aminomethyl)-1,2-benzothiazol-4-amine.
| Compound Name | 3-(aminomethyl)-1,2-benzothiazol-4-amine |
|---|---|
| PubChem CID | 84767967 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 3-(aminomethyl)-1,2-benzothiazol-4-amine |
| SMILES | NCc1nsc2cccc(N)c12 |
| InChI | InChI=1S/C8H9N3S/c9-4-6-8-5(10)2-1-3-7(8)12-11-6/h1-3H,4,9-10H2 |
| InChIKey | HMQVQRCTOPZELO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|