C8H6FNOS — CID 84768962
7-fluoro-1,4-dihydro-3,1-benzoxazine-2-thione (PubChem CID 84768962) has the molecular formula C8H6FNOS and a molecular weight of 183.21 g/mol. Its IUPAC name is 7-fluoro-1,4-dihydro-3,1-benzoxazine-2-thione.
| Compound Name | 7-fluoro-1,4-dihydro-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 84768962 |
| Molecular Formula | C8H6FNOS |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 7-fluoro-1,4-dihydro-3,1-benzoxazine-2-thione |
| SMILES | Fc1ccc2c(c1)NC(=S)OC2 |
| InChI | InChI=1S/C8H6FNOS/c9-6-2-1-5-4-11-8(12)10-7(5)3-6/h1-3H,4H2,(H,10,12) |
| InChIKey | BWECNVVJEUEEIJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|