C8H7NO2S — CID 84768412
6-hydroxy-1,4-dihydro-3,1-benzoxazine-2-thione (PubChem CID 84768412) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 6-hydroxy-1,4-dihydro-3,1-benzoxazine-2-thione.
| Compound Name | 6-hydroxy-1,4-dihydro-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 84768412 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 6-hydroxy-1,4-dihydro-3,1-benzoxazine-2-thione |
| SMILES | Oc1ccc2c(c1)COC(=S)N2 |
| InChI | InChI=1S/C8H7NO2S/c10-6-1-2-7-5(3-6)4-11-8(12)9-7/h1-3,10H,4H2,(H,9,12) |
| InChIKey | MDFRVCYECGMBND-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|