C11H14FNO — CID 84720475
4-fluoro-4-methyl-1,2,3,5-tetrahydro-1-benzazepin-7-ol (PubChem CID 84720475) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 4-fluoro-4-methyl-1,2,3,5-tetrahydro-1-benzazepin-7-ol.
| Compound Name | 4-fluoro-4-methyl-1,2,3,5-tetrahydro-1-benzazepin-7-ol |
|---|---|
| PubChem CID | 84720475 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 4-fluoro-4-methyl-1,2,3,5-tetrahydro-1-benzazepin-7-ol |
| SMILES | CC1(F)CCNc2ccc(O)cc2C1 |
| InChI | InChI=1S/C11H14FNO/c1-11(12)4-5-13-10-3-2-9(14)6-8(10)7-11/h2-3,6,13-14H,4-5,7H2,1H3 |
| InChIKey | JRDWEMBIDQDJRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|