C9H9NO2 — CID 59504541
4,4-dideuterio-6-hydroxy-1,3-dihydroquinolin-2-one (PubChem CID 59504541) has the molecular formula C9H9NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 4,4-dideuterio-6-hydroxy-1,3-dihydroquinolin-2-one.
| Compound Name | 4,4-dideuterio-6-hydroxy-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 59504541 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4,4-dideuterio-6-hydroxy-1,3-dihydroquinolin-2-one |
| SMILES | [2H]C1([2H])CC(=O)Nc2ccc(O)cc21 |
| InChI | InChI=1S/C9H9NO2/c11-7-2-3-8-6(5-7)1-4-9(12)10-8/h2-3,5,11H,1,4H2,(H,10,12)/i1D2 |
| InChIKey | HOSGXJWQVBHGLT-DICFDUPASA-N |
| XLogP | 1.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|