4,4-difluoro-3-propylthiane-3-carboxylic acid

C9H14F2O2S — CID 84789719

IUPAC4,4-difluoro-3-propylthiane-3-carboxylic acid
SMILESCCCC1(C(=O)O)CSCCC1(F)F
InChIInChI=1S/C9H14F2O2S/c1-2-3-8(7(12)13)6-14-5-4-9(8,10)11/h2-6H2,1H3,(H,12,13)
InChIKeyWRDIVCLSOCSBGV-UHFFFAOYSA-N
MW224.27 g/mol
LogP2.63
Rot. Bonds3

About 4,4-difluoro-3-propylthiane-3-carboxylic acid

4,4-difluoro-3-propylthiane-3-carboxylic acid (PubChem CID 84789719) has the molecular formula C9H14F2O2S and a molecular weight of 224.27 g/mol. Its IUPAC name is 4,4-difluoro-3-propylthiane-3-carboxylic acid.

Molecular Properties

Compound Name4,4-difluoro-3-propylthiane-3-carboxylic acid
PubChem CID84789719
Molecular FormulaC9H14F2O2S
Molecular Weight224.27 g/mol
Exact Mass224.07
IUPAC Name4,4-difluoro-3-propylthiane-3-carboxylic acid
SMILESCCCC1(C(=O)O)CSCCC1(F)F
InChIInChI=1S/C9H14F2O2S/c1-2-3-8(7(12)13)6-14-5-4-9(8,10)11/h2-6H2,1H3,(H,12,13)
InChIKeyWRDIVCLSOCSBGV-UHFFFAOYSA-N
XLogP2.63
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.27
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4,4-difluoro-3-propylthiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-difluoro-3-propylthiane-3-carboxylic acid?
The IUPAC name of 4,4-difluoro-3-propylthiane-3-carboxylic acid (CID 84789719) is 4,4-difluoro-3-propylthiane-3-carboxylic acid.
What is the SMILES notation for 4,4-difluoro-3-propylthiane-3-carboxylic acid?
The canonical SMILES for 4,4-difluoro-3-propylthiane-3-carboxylic acid is CCCC1(C(=O)O)CSCCC1(F)F.
What is the InChIKey of 4,4-difluoro-3-propylthiane-3-carboxylic acid?
The InChIKey is WRDIVCLSOCSBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O2S/c1-2-3-8(7(12)13)6-14-5-4-9(8,10)11/h2-6H2,1H3,(H,12,13).
What are the key properties of 4,4-difluoro-3-propylthiane-3-carboxylic acid?
4,4-difluoro-3-propylthiane-3-carboxylic acid has a molecular weight of 224.27 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3-propylthiane-3-carboxylic acid is sourced from PubChem (CID 84789719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).