2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid

C7H10F2O4S — CID 84792114

IUPAC2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid
SMILESO=C(O)CC1CS(=O)(=O)CCC1(F)F
InChIInChI=1S/C7H10F2O4S/c8-7(9)1-2-14(12,13)4-5(7)3-6(10)11/h5H,1-4H2,(H,10,11)
InChIKeyQGVHSWZKGDCGRK-UHFFFAOYSA-N
MW228.22 g/mol
LogP0.53
Rot. Bonds2

About 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid

2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid (PubChem CID 84792114) has the molecular formula C7H10F2O4S and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid
PubChem CID84792114
Molecular FormulaC7H10F2O4S
Molecular Weight228.22 g/mol
Exact Mass228.03
IUPAC Name2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid
SMILESO=C(O)CC1CS(=O)(=O)CCC1(F)F
InChIInChI=1S/C7H10F2O4S/c8-7(9)1-2-14(12,13)4-5(7)3-6(10)11/h5H,1-4H2,(H,10,11)
InChIKeyQGVHSWZKGDCGRK-UHFFFAOYSA-N
XLogP0.53
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.22
LogP ≤ 50.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid?
The IUPAC name of 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid (CID 84792114) is 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid.
What is the SMILES notation for 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid?
The canonical SMILES for 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid is O=C(O)CC1CS(=O)(=O)CCC1(F)F.
What is the InChIKey of 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid?
The InChIKey is QGVHSWZKGDCGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O4S/c8-7(9)1-2-14(12,13)4-5(7)3-6(10)11/h5H,1-4H2,(H,10,11).
What are the key properties of 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid?
2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid has a molecular weight of 228.22 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoro-1,1-dioxothian-3-yl)acetic acid is sourced from PubChem (CID 84792114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).