C7H10F2O4S — CID 84792115
4-(difluoromethyl)-1,1-dioxothiane-4-carboxylic acid (PubChem CID 84792115) has the molecular formula C7H10F2O4S and a molecular weight of 228.22 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,1-dioxothiane-4-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-1,1-dioxothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 84792115 |
| Molecular Formula | C7H10F2O4S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 4-(difluoromethyl)-1,1-dioxothiane-4-carboxylic acid |
| SMILES | O=C(O)C1(C(F)F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H10F2O4S/c8-5(9)7(6(10)11)1-3-14(12,13)4-2-7/h5H,1-4H2,(H,10,11) |
| InChIKey | VTRNUQQUJXCIMZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |