C30H27ClP2Ru — CID 84819438
chlororuthenium(1+);cyclopenta-1,3-diene;diphenylphosphanylmethyl(diphenyl)phosphane (PubChem CID 84819438) has the molecular formula C30H27ClP2Ru and a molecular weight of 586.02 g/mol. Its IUPAC name is chlororuthenium(1+);cyclopenta-1,3-diene;diphenylphosphanylmethyl(diphenyl)phosphane.
| Compound Name | chlororuthenium(1+);cyclopenta-1,3-diene;diphenylphosphanylmethyl(diphenyl)phosphane |
|---|---|
| PubChem CID | 84819438 |
| Molecular Formula | C30H27ClP2Ru |
| Molecular Weight | 586.02 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | chlororuthenium(1+);cyclopenta-1,3-diene;diphenylphosphanylmethyl(diphenyl)phosphane |
| SMILES | Cl[Ru+].[C-]1=CC=CC1.c1ccc(P(CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P2.C5H5.ClH.Ru/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-2-4-5-3-1;;/h1-20H,21H2;1-3H,4H2;1H;/q;-1;;+2/p-1 |
| InChIKey | HIUCLICYSZRRGX-UHFFFAOYSA-M |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.02 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|