C31H44O4 — CID 85110018
7-(3,7-dimethylocta-2,6-dienyl)-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one (PubChem CID 85110018) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is 7-(3,7-dimethylocta-2,6-dienyl)-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one.
| Compound Name | 7-(3,7-dimethylocta-2,6-dienyl)-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one |
|---|---|
| PubChem CID | 85110018 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 7-(3,7-dimethylocta-2,6-dienyl)-12,13-dihydroxy-2,2,10-trimethyl-5-(3-methylbut-2-enyl)-3-oxatetracyclo[9.2.1.04,13.07,12]tetradeca-4,9-dien-6-one |
| SMILES | CC(C)=CCCC(C)=CCC12CC=C(C)C3CC4C(C)(C)OC(=C(CC=C(C)C)C1=O)C4(O)C32O |
| InChI | InChI=1S/C31H44O4/c1-19(2)10-9-11-21(5)14-16-29-17-15-22(6)24-18-25-28(7,8)35-27(30(25,33)31(24,29)34)23(26(29)32)13-12-20(3)4/h10,12,14-15,24-25,33-34H,9,11,13,16-18H2,1-8H3 |
| InChIKey | HZWODYNDACKNRH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|