C19H26N2O3 — CID 8519598
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 8519598) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] adamantane-2-carboxylate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8519598 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | C[C@](C#N)(NC(=O)COC(=O)C1C2CC3CC(C2)CC1C3)C1CC1 |
| InChI | InChI=1S/C19H26N2O3/c1-19(10-20,15-2-3-15)21-16(22)9-24-18(23)17-13-5-11-4-12(7-13)8-14(17)6-11/h11-15,17H,2-9H2,1H3,(H,21,22)/t11?,12?,13?,14?,17?,19-/m1/s1 |
| InChIKey | GGLUKUJKLJNXQE-DWLQEXBCSA-N |
| XLogP | 2.41 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |