C7H6O2 — CID 85230200
tricyclo[4.1.0.01,3]heptane-4,5-dione (PubChem CID 85230200) has the molecular formula C7H6O2 and a molecular weight of 122.12 g/mol. Its IUPAC name is tricyclo[4.1.0.01,3]heptane-4,5-dione.
| Compound Name | tricyclo[4.1.0.01,3]heptane-4,5-dione |
|---|---|
| PubChem CID | 85230200 |
| Molecular Formula | C7H6O2 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | tricyclo[4.1.0.01,3]heptane-4,5-dione |
| SMILES | O=C1C(=O)C2CC23CC13 |
| InChI | InChI=1S/C7H6O2/c8-5-3-1-7(3)2-4(7)6(5)9/h3-4H,1-2H2 |
| InChIKey | VESHFNBQQWPOLH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|