C18H16N4O3S — CID 85267047
3-diazo-N-[4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]-2-oxopropanamide (PubChem CID 85267047) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 3-diazo-N-[4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]-2-oxopropanamide.
| Compound Name | 3-diazo-N-[4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 85267047 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-diazo-N-[4-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]-2-oxopropanamide |
| SMILES | Cc1ccc(SCC(=O)Nc2ccc(NC(=O)C(=O)C=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c1-12-2-8-15(9-3-12)26-11-17(24)21-13-4-6-14(7-5-13)22-18(25)16(23)10-20-19/h2-10H,11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | IFGPACTVGMPPDR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|