About 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol
2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol (PubChem CID 8529045) has the molecular formula C19H22BrN2O3+
and a molecular weight of 406.30 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol.
Molecular Properties
| Compound Name | 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol |
| PubChem CID | 8529045 |
| Molecular Formula | C19H22BrN2O3+ |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol |
| SMILES | Oc1ccccc1N1CC[NH+](Cc2cc3c(cc2Br)OCCO3)CC1 |
| InChI | InChI=1S/C19H21BrN2O3/c20-15-12-19-18(24-9-10-25-19)11-14(15)13-21-5-7-22(8-6-21)16-3-1-2-4-17(16)23/h1-4,11-12,23H,5-10,13H2/p+1 |
| InChIKey | ZSLYPYLCUPBJTJ-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 46.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol?
The IUPAC name of 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol (CID 8529045) is 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol.
What is the SMILES notation for 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol?
The canonical SMILES for 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol is Oc1ccccc1N1CC[NH+](Cc2cc3c(cc2Br)OCCO3)CC1.
What is the InChIKey of 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol?
The InChIKey is ZSLYPYLCUPBJTJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H21BrN2O3/c20-15-12-19-18(24-9-10-25-19)11-14(15)13-21-5-7-22(8-6-21)16-3-1-2-4-17(16)23/h1-4,11-12,23H,5-10,13H2/p+1.
What are the key properties of 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol?
2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol has a molecular weight of 406.30 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]piperazin-4-ium-1-yl]phenol is sourced from PubChem (CID 8529045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).