C10H9F3O3S — CID 85308567
2,3,3-trifluoroprop-1-enyl 4-methylbenzenesulfonate (PubChem CID 85308567) has the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. Its IUPAC name is 2,3,3-trifluoroprop-1-enyl 4-methylbenzenesulfonate.
| Compound Name | 2,3,3-trifluoroprop-1-enyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 85308567 |
| Molecular Formula | C10H9F3O3S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 2,3,3-trifluoroprop-1-enyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC=C(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H9F3O3S/c1-7-2-4-8(5-3-7)17(14,15)16-6-9(11)10(12)13/h2-6,10H,1H3 |
| InChIKey | OJRFVQVTRZONNA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|