C15H17F3O3S — CID 10969683
[(2Z,4E)-4-ethyl-1,1,2-trifluorohexa-2,4-dien-3-yl] 4-methylbenzenesulfonate (PubChem CID 10969683) has the molecular formula C15H17F3O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is [(2Z,4E)-4-ethyl-1,1,2-trifluorohexa-2,4-dien-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2Z,4E)-4-ethyl-1,1,2-trifluorohexa-2,4-dien-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10969683 |
| Molecular Formula | C15H17F3O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [(2Z,4E)-4-ethyl-1,1,2-trifluorohexa-2,4-dien-3-yl] 4-methylbenzenesulfonate |
| SMILES | C/C=C(CC)/C(OS(=O)(=O)c1ccc(C)cc1)=C(/F)C(F)F |
| InChI | InChI=1S/C15H17F3O3S/c1-4-11(5-2)14(13(16)15(17)18)21-22(19,20)12-8-6-10(3)7-9-12/h4,6-9,15H,5H2,1-3H3/b11-4+,14-13- |
| InChIKey | VCMVLLVUZJFZOX-OBGXGDGJSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|