C19H35N3O6Si — CID 85336683
tert-butyl N-[4-methyl-1-oxo-1-[5-oxo-4-(2-trimethylsilylethoxymethyl)-1,3,4-oxadiazol-2-yl]pentan-2-yl]carbamate (PubChem CID 85336683) has the molecular formula C19H35N3O6Si and a molecular weight of 429.59 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-oxo-1-[5-oxo-4-(2-trimethylsilylethoxymethyl)-1,3,4-oxadiazol-2-yl]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-oxo-1-[5-oxo-4-(2-trimethylsilylethoxymethyl)-1,3,4-oxadiazol-2-yl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 85336683 |
| Molecular Formula | C19H35N3O6Si |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | tert-butyl N-[4-methyl-1-oxo-1-[5-oxo-4-(2-trimethylsilylethoxymethyl)-1,3,4-oxadiazol-2-yl]pentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)c1nn(COCC[Si](C)(C)C)c(=O)o1 |
| InChI | InChI=1S/C19H35N3O6Si/c1-13(2)11-14(20-17(24)28-19(3,4)5)15(23)16-21-22(18(25)27-16)12-26-9-10-29(6,7)8/h13-14H,9-12H2,1-8H3,(H,20,24) |
| InChIKey | DZSNRJHOJPGXHG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|