C8H10N4O — CID 853567
5-amino-1,3-dimethylimidazo[4,5-b]pyridin-2-one (PubChem CID 853567) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-amino-1,3-dimethylimidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-amino-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 853567 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 5-amino-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(C)c2nc(N)ccc21 |
| InChI | InChI=1S/C8H10N4O/c1-11-5-3-4-6(9)10-7(5)12(2)8(11)13/h3-4H,1-2H3,(H2,9,10) |
| InChIKey | KXEGNVALPDAZSJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |