C12H17N3O — CID 138655254
5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one (PubChem CID 138655254) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 138655254 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(C)c2nc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C12H17N3O/c1-12(2,3)9-7-6-8-10(13-9)15(5)11(16)14(8)4/h6-7H,1-5H3 |
| InChIKey | GBAMYERZDGAGCZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |