About 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one
5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one (PubChem CID 138655254) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 138655254 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(C)c2nc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C12H17N3O/c1-12(2,3)9-7-6-8-10(13-9)15(5)11(16)14(8)4/h6-7H,1-5H3 |
| InChIKey | GBAMYERZDGAGCZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one (CID 138655254) is 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one is Cn1c(=O)n(C)c2nc(C(C)(C)C)ccc21.
What is the InChIKey of 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
The InChIKey is GBAMYERZDGAGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-12(2,3)9-7-6-8-10(13-9)15(5)11(16)14(8)4/h6-7H,1-5H3.
What are the key properties of 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one?
5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one has a molecular weight of 219.29 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,3-dimethylimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 138655254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).