C26H23F4N5O2 — CID 85469073
3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 85469073) has the molecular formula C26H23F4N5O2 and a molecular weight of 513.50 g/mol. Its IUPAC name is 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85469073 |
| Molecular Formula | C26H23F4N5O2 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | CN1CCN(Cc2cccc(-c3c(F)c(F)c(-c4cc(C(=O)O)c5c(c4)nnn5C)c(F)c3F)c2)CC1 |
| InChI | InChI=1S/C26H23F4N5O2/c1-33-6-8-35(9-7-33)13-14-4-3-5-15(10-14)19-21(27)23(29)20(24(30)22(19)28)16-11-17(26(36)37)25-18(12-16)31-32-34(25)2/h3-5,10-12H,6-9,13H2,1-2H3,(H,36,37) |
| InChIKey | FNUTZPNSCOECCA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|