C20H11F4N3O2 — CID 85468975
2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzotriazole-4-carboxylic acid (PubChem CID 85468975) has the molecular formula C20H11F4N3O2 and a molecular weight of 401.32 g/mol. Its IUPAC name is 2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzotriazole-4-carboxylic acid.
| Compound Name | 2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85468975 |
| Molecular Formula | C20H11F4N3O2 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-methyl-6-(2,3,5,6-tetrafluoro-4-phenylphenyl)benzotriazole-4-carboxylic acid |
| SMILES | Cn1nc2cc(-c3c(F)c(F)c(-c4ccccc4)c(F)c3F)cc(C(=O)O)c2n1 |
| InChI | InChI=1S/C20H11F4N3O2/c1-27-25-12-8-10(7-11(20(28)29)19(12)26-27)14-17(23)15(21)13(16(22)18(14)24)9-5-3-2-4-6-9/h2-8H,1H3,(H,28,29) |
| InChIKey | AGPUYFMACXDOSL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|