C25H20F4N4O3 — CID 85469126
2-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 85469126) has the molecular formula C25H20F4N4O3 and a molecular weight of 500.45 g/mol. Its IUPAC name is 2-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 2-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85469126 |
| Molecular Formula | C25H20F4N4O3 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | Cn1nc2cc(-c3c(F)c(F)c(-c4cccc(CN5CCOCC5)c4)c(F)c3F)cc(C(=O)O)c2n1 |
| InChI | InChI=1S/C25H20F4N4O3/c1-32-30-17-11-15(10-16(25(34)35)24(17)31-32)19-22(28)20(26)18(21(27)23(19)29)14-4-2-3-13(9-14)12-33-5-7-36-8-6-33/h2-4,9-11H,5-8,12H2,1H3,(H,34,35) |
| InChIKey | VMQALOAHLDPKQC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|