C22H16F4N4O2 — CID 85469124
3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 85469124) has the molecular formula C22H16F4N4O2 and a molecular weight of 444.39 g/mol. Its IUPAC name is 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85469124 |
| Molecular Formula | C22H16F4N4O2 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(methylaminomethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | CNCc1cccc(-c2c(F)c(F)c(-c3cc(C(=O)O)c4c(c3)nnn4C)c(F)c2F)c1 |
| InChI | InChI=1S/C22H16F4N4O2/c1-27-9-10-4-3-5-11(6-10)15-17(23)19(25)16(20(26)18(15)24)12-7-13(22(31)32)21-14(8-12)28-29-30(21)2/h3-8,27H,9H2,1-2H3,(H,31,32) |
| InChIKey | SWIRELOGAITFNG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|