C16H22F2N3O4+ — CID 8549332
N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide (PubChem CID 8549332) has the molecular formula C16H22F2N3O4+ and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8549332 |
| Molecular Formula | C16H22F2N3O4+ |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
| SMILES | COc1cc(CCNC(=O)C[NH+]2CCNC(=O)C2)ccc1OC(F)F |
| InChI | InChI=1S/C16H21F2N3O4/c1-24-13-8-11(2-3-12(13)25-16(17)18)4-5-19-14(22)9-21-7-6-20-15(23)10-21/h2-3,8,16H,4-7,9-10H2,1H3,(H,19,22)(H,20,23)/p+1 |
| InChIKey | YRAXGOXINBVLNJ-UHFFFAOYSA-O |
| XLogP | -1.03 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |