C19H17NO3S — CID 8565364
methyl 4-methyl-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]benzoate (PubChem CID 8565364) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is methyl 4-methyl-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]benzoate.
| Compound Name | methyl 4-methyl-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 8565364 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | methyl 4-methyl-3-[(3-methyl-1-benzothiophene-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2sc3ccccc3c2C)c1 |
| InChI | InChI=1S/C19H17NO3S/c1-11-8-9-13(19(22)23-3)10-15(11)20-18(21)17-12(2)14-6-4-5-7-16(14)24-17/h4-10H,1-3H3,(H,20,21) |
| InChIKey | NVVMQUNJEJZTJD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |