C12H15NO2 — CID 86004687
2-(2-isocyanatopropoxy)-1,3-dimethylbenzene (PubChem CID 86004687) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(2-isocyanatopropoxy)-1,3-dimethylbenzene.
| Compound Name | 2-(2-isocyanatopropoxy)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 86004687 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(2-isocyanatopropoxy)-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1OCC(C)N=C=O |
| InChI | InChI=1S/C12H15NO2/c1-9-5-4-6-10(2)12(9)15-7-11(3)13-8-14/h4-6,11H,7H2,1-3H3 |
| InChIKey | PVNFYWUOYCJVMD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|