C12H12N2O2 — CID 86019392
2-(furan-2-yl)-1-hydroxy-3,4-dihydro-2H-quinazoline (PubChem CID 86019392) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-hydroxy-3,4-dihydro-2H-quinazoline.
| Compound Name | 2-(furan-2-yl)-1-hydroxy-3,4-dihydro-2H-quinazoline |
|---|---|
| PubChem CID | 86019392 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-(furan-2-yl)-1-hydroxy-3,4-dihydro-2H-quinazoline |
| SMILES | ON1c2ccccc2CNC1c1ccco1 |
| InChI | InChI=1S/C12H12N2O2/c15-14-10-5-2-1-4-9(10)8-13-12(14)11-6-3-7-16-11/h1-7,12-13,15H,8H2 |
| InChIKey | XECZKZMHAKLYJJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |