C12H17N — CID 86031429
1-(1-cyclopenta-2,4-dien-1-ylideneethyl)piperidine (PubChem CID 86031429) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-(1-cyclopenta-2,4-dien-1-ylideneethyl)piperidine.
| Compound Name | 1-(1-cyclopenta-2,4-dien-1-ylideneethyl)piperidine |
|---|---|
| PubChem CID | 86031429 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-(1-cyclopenta-2,4-dien-1-ylideneethyl)piperidine |
| SMILES | CC(=C1C=CC=C1)N1CCCCC1 |
| InChI | InChI=1S/C12H17N/c1-11(12-7-3-4-8-12)13-9-5-2-6-10-13/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | PCVFNHAIPUVBEK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |