C17H15N2O+ — CID 86046103
13-methyl-5,6-dihydroisoquinolino[1,2-b]quinazolin-13-ium-8-one (PubChem CID 86046103) has the molecular formula C17H15N2O+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 13-methyl-5,6-dihydroisoquinolino[1,2-b]quinazolin-13-ium-8-one.
| Compound Name | 13-methyl-5,6-dihydroisoquinolino[1,2-b]quinazolin-13-ium-8-one |
|---|---|
| PubChem CID | 86046103 |
| Molecular Formula | C17H15N2O+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 13-methyl-5,6-dihydroisoquinolino[1,2-b]quinazolin-13-ium-8-one |
| SMILES | C[n+]1c2n(c(=O)c3ccccc31)CCc1ccccc1-2 |
| InChI | InChI=1S/C17H15N2O/c1-18-15-9-5-4-8-14(15)17(20)19-11-10-12-6-2-3-7-13(12)16(18)19/h2-9H,10-11H2,1H3/q+1 |
| InChIKey | ZWLYQJVBBSZQHW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|