C18H16N+ — CID 11211486
6-methyl-11,12-dihydrobenzo[i]phenanthridin-6-ium (PubChem CID 11211486) has the molecular formula C18H16N+ and a molecular weight of 246.33 g/mol. Its IUPAC name is 6-methyl-11,12-dihydrobenzo[i]phenanthridin-6-ium.
| Compound Name | 6-methyl-11,12-dihydrobenzo[i]phenanthridin-6-ium |
|---|---|
| PubChem CID | 11211486 |
| Molecular Formula | C18H16N+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 6-methyl-11,12-dihydrobenzo[i]phenanthridin-6-ium |
| SMILES | C[n+]1cc2c(c3ccccc31)CCc1ccccc1-2 |
| InChI | InChI=1S/C18H16N/c1-19-12-17-14-7-3-2-6-13(14)10-11-15(17)16-8-4-5-9-18(16)19/h2-9,12H,10-11H2,1H3/q+1 |
| InChIKey | BJDIMDIUEPYYKY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|