C16H21NO — CID 86050508
7-methoxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene (PubChem CID 86050508) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 7-methoxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene.
| Compound Name | 7-methoxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene |
|---|---|
| PubChem CID | 86050508 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 7-methoxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene |
| SMILES | COc1cc2c3c(c1)C(C)=CC(C)(C)N3CCC2 |
| InChI | InChI=1S/C16H21NO/c1-11-10-16(2,3)17-7-5-6-12-8-13(18-4)9-14(11)15(12)17/h8-10H,5-7H2,1-4H3 |
| InChIKey | ONGQGPWBQQEZNW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|